C14H29NS2 — CID 79965382
1-(1,4-dithian-2-yl)-N-methylnonan-1-amine (PubChem CID 79965382) has the molecular formula C14H29NS2 and a molecular weight of 275.53 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-methylnonan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 79965382 |
| Molecular Formula | C14H29NS2 |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-methylnonan-1-amine |
| SMILES | CCCCCCCCC(NC)C1CSCCS1 |
| InChI | InChI=1S/C14H29NS2/c1-3-4-5-6-7-8-9-13(15-2)14-12-16-10-11-17-14/h13-15H,3-12H2,1-2H3 |
| InChIKey | BJWGVIFTHNIKEH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|