C8H17NS2 — CID 79966250
1-(1,4-dithian-2-yl)-N-methylpropan-1-amine (PubChem CID 79966250) has the molecular formula C8H17NS2 and a molecular weight of 191.36 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-methylpropan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79966250 |
| Molecular Formula | C8H17NS2 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-methylpropan-1-amine |
| SMILES | CCC(NC)C1CSCCS1 |
| InChI | InChI=1S/C8H17NS2/c1-3-7(9-2)8-6-10-4-5-11-8/h7-9H,3-6H2,1-2H3 |
| InChIKey | QCWSOKYMYRRANM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |