C14H29NS2 — CID 114200967
1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine (PubChem CID 114200967) has the molecular formula C14H29NS2 and a molecular weight of 275.53 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114200967 |
| Molecular Formula | C14H29NS2 |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)C)C1CSCCS1 |
| InChI | InChI=1S/C14H29NS2/c1-5-15-13(9-12(4)8-11(2)3)14-10-16-6-7-17-14/h11-15H,5-10H2,1-4H3 |
| InChIKey | RCJGPOWFNKGIAS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |