About 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine
1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine (PubChem CID 114200967) has the molecular formula C14H29NS2
and a molecular weight of 275.53 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine |
| PubChem CID | 114200967 |
| Molecular Formula | C14H29NS2 |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine |
| SMILES | CCNC(CC(C)CC(C)C)C1CSCCS1 |
| InChI | InChI=1S/C14H29NS2/c1-5-15-13(9-12(4)8-11(2)3)14-10-16-6-7-17-14/h11-15H,5-10H2,1-4H3 |
| InChIKey | RCJGPOWFNKGIAS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine?
The IUPAC name of 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine (CID 114200967) is 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine.
What is the SMILES notation for 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine?
The canonical SMILES for 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine is CCNC(CC(C)CC(C)C)C1CSCCS1.
What is the InChIKey of 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine?
The InChIKey is RCJGPOWFNKGIAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NS2/c1-5-15-13(9-12(4)8-11(2)3)14-10-16-6-7-17-14/h11-15H,5-10H2,1-4H3.
What are the key properties of 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine?
1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine has a molecular weight of 275.53 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dithian-2-yl)-N-ethyl-3,5-dimethylhexan-1-amine is sourced from PubChem (CID 114200967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).