C15H22BrNOS2 — CID 79965642
2-(5-bromo-2-methoxyphenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine (PubChem CID 79965642) has the molecular formula C15H22BrNOS2 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79965642 |
| Molecular Formula | C15H22BrNOS2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1-(1,4-dithian-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Br)ccc1OC)C1CSCCS1 |
| InChI | InChI=1S/C15H22BrNOS2/c1-3-17-13(15-10-19-6-7-20-15)9-11-8-12(16)4-5-14(11)18-2/h4-5,8,13,15,17H,3,6-7,9-10H2,1-2H3 |
| InChIKey | QJWBBHVLRKKYIP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |