C15H23NS2 — CID 79971420
1-(1,4-dithian-2-yl)-N-ethyl-2-(3-methylphenyl)ethanamine (PubChem CID 79971420) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-ethyl-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 79971420 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-(3-methylphenyl)ethanamine |
| SMILES | CCNC(Cc1cccc(C)c1)C1CSCCS1 |
| InChI | InChI=1S/C15H23NS2/c1-3-16-14(15-11-17-7-8-18-15)10-13-6-4-5-12(2)9-13/h4-6,9,14-16H,3,7-8,10-11H2,1-2H3 |
| InChIKey | DWKVPBGXXLMZDL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |