C15H23NOS2 — CID 79965549
1-(1,4-dithian-2-yl)-N-ethyl-2-(2-methoxyphenyl)ethanamine (PubChem CID 79965549) has the molecular formula C15H23NOS2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-N-ethyl-2-(2-methoxyphenyl)ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 79965549 |
| Molecular Formula | C15H23NOS2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-N-ethyl-2-(2-methoxyphenyl)ethanamine |
| SMILES | CCNC(Cc1ccccc1OC)C1CSCCS1 |
| InChI | InChI=1S/C15H23NOS2/c1-3-16-13(15-11-18-8-9-19-15)10-12-6-4-5-7-14(12)17-2/h4-7,13,15-16H,3,8-11H2,1-2H3 |
| InChIKey | NTOOVFQPNKYFJC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |