C13H19NOS2 — CID 79971404
1-(1,4-dithian-2-yl)-2-(2-methoxyphenyl)ethanamine (PubChem CID 79971404) has the molecular formula C13H19NOS2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(2-methoxyphenyl)ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-2-(2-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 79971404 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(2-methoxyphenyl)ethanamine |
| SMILES | COc1ccccc1CC(N)C1CSCCS1 |
| InChI | InChI=1S/C13H19NOS2/c1-15-12-5-3-2-4-10(12)8-11(14)13-9-16-6-7-17-13/h2-5,11,13H,6-9,14H2,1H3 |
| InChIKey | RCJYUAMLCCAYPZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |