C14H21NO2S2 — CID 104660478
1,4-dithian-2-yl-[2-(2-methoxyethoxy)phenyl]methanamine (PubChem CID 104660478) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1,4-dithian-2-yl-[2-(2-methoxyethoxy)phenyl]methanamine.
| Compound Name | 1,4-dithian-2-yl-[2-(2-methoxyethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 104660478 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1,4-dithian-2-yl-[2-(2-methoxyethoxy)phenyl]methanamine |
| SMILES | COCCOc1ccccc1C(N)C1CSCCS1 |
| InChI | InChI=1S/C14H21NO2S2/c1-16-6-7-17-12-5-3-2-4-11(12)14(15)13-10-18-8-9-19-13/h2-5,13-14H,6-10,15H2,1H3 |
| InChIKey | XCLOPAPTCSRCBQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|