C15H25NO2 — CID 105035367
1-[2-(2-methoxyethoxy)phenyl]-2,3-dimethylbutan-1-amine (PubChem CID 105035367) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)phenyl]-2,3-dimethylbutan-1-amine.
| Compound Name | 1-[2-(2-methoxyethoxy)phenyl]-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 105035367 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)phenyl]-2,3-dimethylbutan-1-amine |
| SMILES | COCCOc1ccccc1C(N)C(C)C(C)C |
| InChI | InChI=1S/C15H25NO2/c1-11(2)12(3)15(16)13-7-5-6-8-14(13)18-10-9-17-4/h5-8,11-12,15H,9-10,16H2,1-4H3 |
| InChIKey | AZSOABBPHUDKGN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|