C14H23NO — CID 115853740
1-(2-ethoxyphenyl)-2,3-dimethylbutan-1-amine (PubChem CID 115853740) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-2,3-dimethylbutan-1-amine.
| Compound Name | 1-(2-ethoxyphenyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 115853740 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(2-ethoxyphenyl)-2,3-dimethylbutan-1-amine |
| SMILES | CCOc1ccccc1C(N)C(C)C(C)C |
| InChI | InChI=1S/C14H23NO/c1-5-16-13-9-7-6-8-12(13)14(15)11(4)10(2)3/h6-11,14H,5,15H2,1-4H3 |
| InChIKey | MYHWNUMRZGJYJI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |