C15H25NO — CID 115853624
1-(2-ethoxyphenyl)-N,2,3-trimethylbutan-1-amine (PubChem CID 115853624) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N,2,3-trimethylbutan-1-amine.
| Compound Name | 1-(2-ethoxyphenyl)-N,2,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 115853624 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N,2,3-trimethylbutan-1-amine |
| SMILES | CCOc1ccccc1C(NC)C(C)C(C)C |
| InChI | InChI=1S/C15H25NO/c1-6-17-14-10-8-7-9-13(14)15(16-5)12(4)11(2)3/h7-12,15-16H,6H2,1-5H3 |
| InChIKey | YHMVORNLFSNCCV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |