C13H18FNOS — CID 104794195
2-(2-fluoro-3-methoxyphenyl)-1-(thiolan-2-yl)ethanamine (PubChem CID 104794195) has the molecular formula C13H18FNOS and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-1-(thiolan-2-yl)ethanamine.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-1-(thiolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 104794195 |
| Molecular Formula | C13H18FNOS |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-1-(thiolan-2-yl)ethanamine |
| SMILES | COc1cccc(CC(N)C2CCCS2)c1F |
| InChI | InChI=1S/C13H18FNOS/c1-16-11-5-2-4-9(13(11)14)8-10(15)12-6-3-7-17-12/h2,4-5,10,12H,3,6-8,15H2,1H3 |
| InChIKey | QRVAYBNLNHBEGD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |