C17H26FNO2 — CID 116771238
1-cyclohexyl-3-(2-fluoro-3-methoxyphenyl)-1-methoxypropan-2-amine (PubChem CID 116771238) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-fluoro-3-methoxyphenyl)-1-methoxypropan-2-amine.
| Compound Name | 1-cyclohexyl-3-(2-fluoro-3-methoxyphenyl)-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 116771238 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-cyclohexyl-3-(2-fluoro-3-methoxyphenyl)-1-methoxypropan-2-amine |
| SMILES | COc1cccc(CC(N)C(OC)C2CCCCC2)c1F |
| InChI | InChI=1S/C17H26FNO2/c1-20-15-10-6-9-13(16(15)18)11-14(19)17(21-2)12-7-4-3-5-8-12/h6,9-10,12,14,17H,3-5,7-8,11,19H2,1-2H3 |
| InChIKey | LCUBVWUXUMNWKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |