C13H17FO3 — CID 103456969
1-cyclopropyl-3-(2-fluoro-3-methoxyphenyl)propane-1,2-diol (PubChem CID 103456969) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-fluoro-3-methoxyphenyl)propane-1,2-diol.
| Compound Name | 1-cyclopropyl-3-(2-fluoro-3-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 103456969 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-cyclopropyl-3-(2-fluoro-3-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1cccc(CC(O)C(O)C2CC2)c1F |
| InChI | InChI=1S/C13H17FO3/c1-17-11-4-2-3-9(12(11)14)7-10(15)13(16)8-5-6-8/h2-4,8,10,13,15-16H,5-7H2,1H3 |
| InChIKey | YAFFTBMBNCGCFT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |