C13H18O3 — CID 103456984
1-cyclopropyl-3-(2-methoxyphenyl)propane-1,2-diol (PubChem CID 103456984) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-methoxyphenyl)propane-1,2-diol.
| Compound Name | 1-cyclopropyl-3-(2-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 103456984 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-cyclopropyl-3-(2-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1ccccc1CC(O)C(O)C1CC1 |
| InChI | InChI=1S/C13H18O3/c1-16-12-5-3-2-4-10(12)8-11(14)13(15)9-6-7-9/h2-5,9,11,13-15H,6-8H2,1H3 |
| InChIKey | PBBDYLGAJYKPHT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |