C14H19ClO — CID 63017211
1-(2-chloro-2-cyclopentylethyl)-2-methoxybenzene (PubChem CID 63017211) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(2-chloro-2-cyclopentylethyl)-2-methoxybenzene.
| Compound Name | 1-(2-chloro-2-cyclopentylethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 63017211 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(2-chloro-2-cyclopentylethyl)-2-methoxybenzene |
| SMILES | COc1ccccc1CC(Cl)C1CCCC1 |
| InChI | InChI=1S/C14H19ClO/c1-16-14-9-5-4-8-12(14)10-13(15)11-6-2-3-7-11/h4-5,8-9,11,13H,2-3,6-7,10H2,1H3 |
| InChIKey | LQDFPXUGSMVPFN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|