C15H21Cl — CID 63542153
1-(2-chloro-2-cyclohexylethyl)-2-methylbenzene (PubChem CID 63542153) has the molecular formula C15H21Cl and a molecular weight of 236.79 g/mol. Its IUPAC name is 1-(2-chloro-2-cyclohexylethyl)-2-methylbenzene.
| Compound Name | 1-(2-chloro-2-cyclohexylethyl)-2-methylbenzene |
|---|---|
| PubChem CID | 63542153 |
| Molecular Formula | C15H21Cl |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(2-chloro-2-cyclohexylethyl)-2-methylbenzene |
| SMILES | Cc1ccccc1CC(Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H21Cl/c1-12-7-5-6-10-14(12)11-15(16)13-8-3-2-4-9-13/h5-7,10,13,15H,2-4,8-9,11H2,1H3 |
| InChIKey | VBFGRPHQYYICDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|