C16H23Cl — CID 63543365
[1-chloro-2-(2-methylphenyl)ethyl]cycloheptane (PubChem CID 63543365) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is [1-chloro-2-(2-methylphenyl)ethyl]cycloheptane.
| Compound Name | [1-chloro-2-(2-methylphenyl)ethyl]cycloheptane |
|---|---|
| PubChem CID | 63543365 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [1-chloro-2-(2-methylphenyl)ethyl]cycloheptane |
| SMILES | Cc1ccccc1CC(Cl)C1CCCCCC1 |
| InChI | InChI=1S/C16H23Cl/c1-13-8-6-7-11-15(13)12-16(17)14-9-4-2-3-5-10-14/h6-8,11,14,16H,2-5,9-10,12H2,1H3 |
| InChIKey | IHCDDMUYFQFWFB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|