C16H26ClNO — CID 17331524
N-[(2-methoxyphenyl)methyl]cyclooctanamine;hydrochloride (PubChem CID 17331524) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]cyclooctanamine;hydrochloride.
| Compound Name | N-[(2-methoxyphenyl)methyl]cyclooctanamine;hydrochloride |
|---|---|
| PubChem CID | 17331524 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]cyclooctanamine;hydrochloride |
| SMILES | COc1ccccc1CNC1CCCCCCC1.Cl |
| InChI | InChI=1S/C16H25NO.ClH/c1-18-16-12-8-7-9-14(16)13-17-15-10-5-3-2-4-6-11-15;/h7-9,12,15,17H,2-6,10-11,13H2,1H3;1H |
| InChIKey | SFVHUKOMNBWMGU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |