C21H36ClNO2 — CID 21435442
N-[(2,4-dimethoxyphenyl)methyl]cyclododecanamine;hydrochloride (PubChem CID 21435442) has the molecular formula C21H36ClNO2 and a molecular weight of 369.98 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]cyclododecanamine;hydrochloride.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]cyclododecanamine;hydrochloride |
|---|---|
| PubChem CID | 21435442 |
| Molecular Formula | C21H36ClNO2 |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]cyclododecanamine;hydrochloride |
| SMILES | COc1ccc(CNC2CCCCCCCCCCC2)c(OC)c1.Cl |
| InChI | InChI=1S/C21H35NO2.ClH/c1-23-20-15-14-18(21(16-20)24-2)17-22-19-12-10-8-6-4-3-5-7-9-11-13-19;/h14-16,19,22H,3-13,17H2,1-2H3;1H |
| InChIKey | DNUNMIDNYRTGJH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |