C14H21NO3 — CID 83228718
N-cyclopentyloxy-1-(2,4-dimethoxyphenyl)methanamine (PubChem CID 83228718) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2,4-dimethoxyphenyl)methanamine.
| Compound Name | N-cyclopentyloxy-1-(2,4-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 83228718 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-cyclopentyloxy-1-(2,4-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(CNOC2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C14H21NO3/c1-16-13-8-7-11(14(9-13)17-2)10-15-18-12-5-3-4-6-12/h7-9,12,15H,3-6,10H2,1-2H3 |
| InChIKey | OFYDIDKFXUPOPV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|