C15H23NO4 — CID 83228531
N-cyclopentyloxy-1-(2,4,5-trimethoxyphenyl)methanamine (PubChem CID 83228531) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2,4,5-trimethoxyphenyl)methanamine.
| Compound Name | N-cyclopentyloxy-1-(2,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 83228531 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-cyclopentyloxy-1-(2,4,5-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c(OC)cc1CNOC1CCCC1 |
| InChI | InChI=1S/C15H23NO4/c1-17-13-9-15(19-3)14(18-2)8-11(13)10-16-20-12-6-4-5-7-12/h8-9,12,16H,4-7,10H2,1-3H3 |
| InChIKey | YRTDCIUQTNUIIB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|