C17H21NO2 — CID 83229536
N-cyclopentyloxy-1-(2-methoxynaphthalen-1-yl)methanamine (PubChem CID 83229536) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2-methoxynaphthalen-1-yl)methanamine.
| Compound Name | N-cyclopentyloxy-1-(2-methoxynaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 83229536 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-cyclopentyloxy-1-(2-methoxynaphthalen-1-yl)methanamine |
| SMILES | COc1ccc2ccccc2c1CNOC1CCCC1 |
| InChI | InChI=1S/C17H21NO2/c1-19-17-11-10-13-6-2-5-9-15(13)16(17)12-18-20-14-7-3-4-8-14/h2,5-6,9-11,14,18H,3-4,7-8,12H2,1H3 |
| InChIKey | GKUDHTDUVSMVNG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|