C13H19NO2 — CID 83229129
N-cyclopentyloxy-1-(2-methoxyphenyl)methanamine (PubChem CID 83229129) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-cyclopentyloxy-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 83229129 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-cyclopentyloxy-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CNOC1CCCC1 |
| InChI | InChI=1S/C13H19NO2/c1-15-13-9-5-2-6-11(13)10-14-16-12-7-3-4-8-12/h2,5-6,9,12,14H,3-4,7-8,10H2,1H3 |
| InChIKey | AMPIYGYWSRHIOH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|