C14H22BrNO2 — CID 75531449
N-[(2,3-dimethoxyphenyl)methyl]cyclopentanamine;hydrobromide (PubChem CID 75531449) has the molecular formula C14H22BrNO2 and a molecular weight of 316.24 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]cyclopentanamine;hydrobromide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]cyclopentanamine;hydrobromide |
|---|---|
| PubChem CID | 75531449 |
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]cyclopentanamine;hydrobromide |
| SMILES | Br.COc1cccc(CNC2CCCC2)c1OC |
| InChI | InChI=1S/C14H21NO2.BrH/c1-16-13-9-5-6-11(14(13)17-2)10-15-12-7-3-4-8-12;/h5-6,9,12,15H,3-4,7-8,10H2,1-2H3;1H |
| InChIKey | UTXYHNOKQVVRDO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |