C10H10F4O2 — CID 104793601
1,1,1-trifluoro-3-(2-fluoro-3-methoxyphenyl)propan-2-ol (PubChem CID 104793601) has the molecular formula C10H10F4O2 and a molecular weight of 238.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(2-fluoro-3-methoxyphenyl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(2-fluoro-3-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 104793601 |
| Molecular Formula | C10H10F4O2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,1,1-trifluoro-3-(2-fluoro-3-methoxyphenyl)propan-2-ol |
| SMILES | COc1cccc(CC(O)C(F)(F)F)c1F |
| InChI | InChI=1S/C10H10F4O2/c1-16-7-4-2-3-6(9(7)11)5-8(15)10(12,13)14/h2-4,8,15H,5H2,1H3 |
| InChIKey | OWBGYWFQAFALJD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |