C13H18FNOS2 — CID 104794151
1-(1,4-dithian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanamine (PubChem CID 104794151) has the molecular formula C13H18FNOS2 and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 104794151 |
| Molecular Formula | C13H18FNOS2 |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(CC(N)C2CSCCS2)c1F |
| InChI | InChI=1S/C13H18FNOS2/c1-16-11-4-2-3-9(13(11)14)7-10(15)12-8-17-5-6-18-12/h2-4,10,12H,5-8,15H2,1H3 |
| InChIKey | IAICWOKCYDERNJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |