C13H19NS2 — CID 79971754
1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethanamine (PubChem CID 79971754) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 79971754 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethanamine |
| SMILES | Cc1cccc(CC(N)C2CSCCS2)c1 |
| InChI | InChI=1S/C13H19NS2/c1-10-3-2-4-11(7-10)8-12(14)13-9-15-5-6-16-13/h2-4,7,12-13H,5-6,8-9,14H2,1H3 |
| InChIKey | WTUXSSZZBBGWST-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |