C13H16F3NOS2 — CID 79973094
1-(1,4-dithian-2-yl)-2-[4-(trifluoromethoxy)phenyl]ethanamine (PubChem CID 79973094) has the molecular formula C13H16F3NOS2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-[4-(trifluoromethoxy)phenyl]ethanamine.
| Compound Name | 1-(1,4-dithian-2-yl)-2-[4-(trifluoromethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 79973094 |
| Molecular Formula | C13H16F3NOS2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-[4-(trifluoromethoxy)phenyl]ethanamine |
| SMILES | NC(Cc1ccc(OC(F)(F)F)cc1)C1CSCCS1 |
| InChI | InChI=1S/C13H16F3NOS2/c14-13(15,16)18-10-3-1-9(2-4-10)7-11(17)12-8-19-5-6-20-12/h1-4,11-12H,5-8,17H2 |
| InChIKey | CCRAPEHKDGUFKP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |