C10H14ClNS3 — CID 79971043
2-(5-chlorothiophen-2-yl)-1-(1,4-dithian-2-yl)ethanamine (PubChem CID 79971043) has the molecular formula C10H14ClNS3 and a molecular weight of 279.88 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-(1,4-dithian-2-yl)ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-(1,4-dithian-2-yl)ethanamine |
|---|---|
| PubChem CID | 79971043 |
| Molecular Formula | C10H14ClNS3 |
| Molecular Weight | 279.88 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-(1,4-dithian-2-yl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)s1)C1CSCCS1 |
| InChI | InChI=1S/C10H14ClNS3/c11-10-2-1-7(15-10)5-8(12)9-6-13-3-4-14-9/h1-2,8-9H,3-6,12H2 |
| InChIKey | LOVZQXIKXICQRO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |