C13H20ClNS — CID 65398933
2-(5-chlorothiophen-2-yl)-1-cycloheptylethanamine (PubChem CID 65398933) has the molecular formula C13H20ClNS and a molecular weight of 257.83 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-cycloheptylethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-cycloheptylethanamine |
|---|---|
| PubChem CID | 65398933 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-cycloheptylethanamine |
| SMILES | NC(Cc1ccc(Cl)s1)C1CCCCCC1 |
| InChI | InChI=1S/C13H20ClNS/c14-13-8-7-11(16-13)9-12(15)10-5-3-1-2-4-6-10/h7-8,10,12H,1-6,9,15H2 |
| InChIKey | CKIYZXWGKUCXRX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |