C9H12ClNS — CID 62602598
2-(5-chlorothiophen-2-yl)-1-cyclopropylethanamine (PubChem CID 62602598) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-cyclopropylethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-cyclopropylethanamine |
|---|---|
| PubChem CID | 62602598 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-cyclopropylethanamine |
| SMILES | NC(Cc1ccc(Cl)s1)C1CC1 |
| InChI | InChI=1S/C9H12ClNS/c10-9-4-3-7(12-9)5-8(11)6-1-2-6/h3-4,6,8H,1-2,5,11H2 |
| InChIKey | MILAGFXEMVLENM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |