C16H26ClNS — CID 115841681
1-(5-chlorothiophen-2-yl)-3-cycloheptyl-N-ethylpropan-2-amine (PubChem CID 115841681) has the molecular formula C16H26ClNS and a molecular weight of 299.91 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-cycloheptyl-N-ethylpropan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-cycloheptyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 115841681 |
| Molecular Formula | C16H26ClNS |
| Molecular Weight | 299.91 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-cycloheptyl-N-ethylpropan-2-amine |
| SMILES | CCNC(Cc1ccc(Cl)s1)CC1CCCCCC1 |
| InChI | InChI=1S/C16H26ClNS/c1-2-18-14(12-15-9-10-16(17)19-15)11-13-7-5-3-4-6-8-13/h9-10,13-14,18H,2-8,11-12H2,1H3 |
| InChIKey | KSTHWUAQWRHLOZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |