C12H20ClNS — CID 62600562
1-(5-chlorothiophen-2-yl)-N-ethyl-4-methylpentan-2-amine (PubChem CID 62600562) has the molecular formula C12H20ClNS and a molecular weight of 245.82 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-ethyl-4-methylpentan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-ethyl-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 62600562 |
| Molecular Formula | C12H20ClNS |
| Molecular Weight | 245.82 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-ethyl-4-methylpentan-2-amine |
| SMILES | CCNC(Cc1ccc(Cl)s1)CC(C)C |
| InChI | InChI=1S/C12H20ClNS/c1-4-14-10(7-9(2)3)8-11-5-6-12(13)15-11/h5-6,9-10,14H,4,7-8H2,1-3H3 |
| InChIKey | YVZYRYLAFAVZAQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |