C11H18ClNOS — CID 79616113
1-(5-chlorothiophen-2-yl)-N-ethyl-3-methoxybutan-2-amine (PubChem CID 79616113) has the molecular formula C11H18ClNOS and a molecular weight of 247.79 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-ethyl-3-methoxybutan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-ethyl-3-methoxybutan-2-amine |
|---|---|
| PubChem CID | 79616113 |
| Molecular Formula | C11H18ClNOS |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-ethyl-3-methoxybutan-2-amine |
| SMILES | CCNC(Cc1ccc(Cl)s1)C(C)OC |
| InChI | InChI=1S/C11H18ClNOS/c1-4-13-10(8(2)14-3)7-9-5-6-11(12)15-9/h5-6,8,10,13H,4,7H2,1-3H3 |
| InChIKey | GWNLSCIJGWKHNB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |