C11H18ClNO2S — CID 106042292
N-[2-(5-chlorothiophen-2-yl)ethyl]-1,1-dimethoxypropan-2-amine (PubChem CID 106042292) has the molecular formula C11H18ClNO2S and a molecular weight of 263.79 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-1,1-dimethoxypropan-2-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1,1-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 106042292 |
| Molecular Formula | C11H18ClNO2S |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(C)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNO2S/c1-8(11(14-2)15-3)13-7-6-9-4-5-10(12)16-9/h4-5,8,11,13H,6-7H2,1-3H3 |
| InChIKey | KHEZRHDWLUMDNB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|