C11H18ClNS — CID 115713587
N-[2-(5-chlorothiophen-2-yl)ethyl]pentan-2-amine (PubChem CID 115713587) has the molecular formula C11H18ClNS and a molecular weight of 231.79 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]pentan-2-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 115713587 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]pentan-2-amine |
| SMILES | CCCC(C)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNS/c1-3-4-9(2)13-8-7-10-5-6-11(12)14-10/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | QPAPTGZSXMNADR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |