C10H14ClNO2S — CID 106036883
3-[2-(5-chlorothiophen-2-yl)ethylamino]butanoic acid (PubChem CID 106036883) has the molecular formula C10H14ClNO2S and a molecular weight of 247.75 g/mol. Its IUPAC name is 3-[2-(5-chlorothiophen-2-yl)ethylamino]butanoic acid.
| Compound Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 106036883 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-[2-(5-chlorothiophen-2-yl)ethylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO2S/c1-7(6-10(13)14)12-5-4-8-2-3-9(11)15-8/h2-3,7,12H,4-6H2,1H3,(H,13,14) |
| InChIKey | TUMLQFPTTRIAGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |