C10H14ClNOS2 — CID 86996141
N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylsulfanylpropanamide (PubChem CID 86996141) has the molecular formula C10H14ClNOS2 and a molecular weight of 263.81 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylsulfanylpropanamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 86996141 |
| Molecular Formula | C10H14ClNOS2 |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNOS2/c1-7(14-2)10(13)12-6-5-8-3-4-9(11)15-8/h3-4,7H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | RHOZJQHHUFDPER-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |