C10H12ClNO3S — CID 103925944
4-[2-(5-chlorothiophen-2-yl)ethylamino]-4-oxobutanoic acid (PubChem CID 103925944) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is 4-[2-(5-chlorothiophen-2-yl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(5-chlorothiophen-2-yl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103925944 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 4-[2-(5-chlorothiophen-2-yl)ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H12ClNO3S/c11-8-2-1-7(16-8)5-6-12-9(13)3-4-10(14)15/h1-2H,3-6H2,(H,12,13)(H,14,15) |
| InChIKey | UJHRMVHLFBLWDM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |