C11H14ClN3O4S — CID 106039693
2-[[2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]acetyl]amino]acetic acid (PubChem CID 106039693) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-[[2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 106039693 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[[2-[2-(5-chlorothiophen-2-yl)ethylcarbamoylamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H14ClN3O4S/c12-8-2-1-7(20-8)3-4-13-11(19)15-5-9(16)14-6-10(17)18/h1-2H,3-6H2,(H,14,16)(H,17,18)(H2,13,15,19) |
| InChIKey | NUOIBLPAENTJRX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |