C12H17ClN2O2S — CID 111438324
1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(1-hydroxycyclobutyl)methyl]urea (PubChem CID 111438324) has the molecular formula C12H17ClN2O2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(1-hydroxycyclobutyl)methyl]urea.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 111438324 |
| Molecular Formula | C12H17ClN2O2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
| SMILES | O=C(NCCc1ccc(Cl)s1)NCC1(O)CCC1 |
| InChI | InChI=1S/C12H17ClN2O2S/c13-10-3-2-9(18-10)4-7-14-11(16)15-8-12(17)5-1-6-12/h2-3,17H,1,4-8H2,(H2,14,15,16) |
| InChIKey | YIRGUIGASTYSEG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |