C7H8ClNO2S — CID 115171101
2-(5-chlorothiophen-2-yl)ethylcarbamic acid (PubChem CID 115171101) has the molecular formula C7H8ClNO2S and a molecular weight of 205.67 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)ethylcarbamic acid.
| Compound Name | 2-(5-chlorothiophen-2-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 115171101 |
| Molecular Formula | C7H8ClNO2S |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)ethylcarbamic acid |
| SMILES | O=C(O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C7H8ClNO2S/c8-6-2-1-5(12-6)3-4-9-7(10)11/h1-2,9H,3-4H2,(H,10,11) |
| InChIKey | CWKQSUSZEHRFDQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |