C8H12Cl2N2OS — CID 119296190
2-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide;hydrochloride (PubChem CID 119296190) has the molecular formula C8H12Cl2N2OS and a molecular weight of 255.17 g/mol. Its IUPAC name is 2-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119296190 |
| Molecular Formula | C8H12Cl2N2OS |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 2-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H11ClN2OS.ClH/c9-7-2-1-6(13-7)3-4-11-8(12)5-10;/h1-2H,3-5,10H2,(H,11,12);1H |
| InChIKey | UQCFMBVHBOCEPI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |