C13H18ClN3O2S — CID 47247812
1-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea (PubChem CID 47247812) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 47247812 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(NCCc1ccc(Cl)s1)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C13H18ClN3O2S/c14-11-4-3-10(20-11)5-6-15-13(19)16-9-12(18)17-7-1-2-8-17/h3-4H,1-2,5-9H2,(H2,15,16,19) |
| InChIKey | BQZFIIMIIMMVTH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |