C9H9ClN2O4S — CID 43387544
2-[[2-[(5-chlorothiophene-2-carbonyl)amino]acetyl]amino]acetic acid (PubChem CID 43387544) has the molecular formula C9H9ClN2O4S and a molecular weight of 276.70 g/mol. Its IUPAC name is 2-[[2-[(5-chlorothiophene-2-carbonyl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5-chlorothiophene-2-carbonyl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43387544 |
| Molecular Formula | C9H9ClN2O4S |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2-[[2-[(5-chlorothiophene-2-carbonyl)amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H9ClN2O4S/c10-6-2-1-5(17-6)9(16)12-3-7(13)11-4-8(14)15/h1-2H,3-4H2,(H,11,13)(H,12,16)(H,14,15) |
| InChIKey | KXXWLYXBGZXMGN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |