C11H8ClNO2S2 — CID 58248868
5-chloro-N-(2-oxo-2-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 58248868) has the molecular formula C11H8ClNO2S2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 5-chloro-N-(2-oxo-2-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2-oxo-2-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58248868 |
| Molecular Formula | C11H8ClNO2S2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 5-chloro-N-(2-oxo-2-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)s1)c1cccs1 |
| InChI | InChI=1S/C11H8ClNO2S2/c12-10-4-3-9(17-10)11(15)13-6-7(14)8-2-1-5-16-8/h1-5H,6H2,(H,13,15) |
| InChIKey | YGJRGILCTLEXLC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |