C10H8ClNO3S3 — CID 58248853
N-[(5-chlorothiophen-2-yl)sulfonylmethyl]thiophene-2-carboxamide (PubChem CID 58248853) has the molecular formula C10H8ClNO3S3 and a molecular weight of 321.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)sulfonylmethyl]thiophene-2-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)sulfonylmethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58248853 |
| Molecular Formula | C10H8ClNO3S3 |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)sulfonylmethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCS(=O)(=O)c1ccc(Cl)s1)c1cccs1 |
| InChI | InChI=1S/C10H8ClNO3S3/c11-8-3-4-9(17-8)18(14,15)6-12-10(13)7-2-1-5-16-7/h1-5H,6H2,(H,12,13) |
| InChIKey | JJZIMKZADZDGOD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |