C13H13ClN2OS2 — CID 6517677
N-[(Z)-1-(5-chlorothiophen-2-yl)butylideneamino]thiophene-2-carboxamide (PubChem CID 6517677) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is N-[(Z)-1-(5-chlorothiophen-2-yl)butylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-1-(5-chlorothiophen-2-yl)butylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6517677 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-[(Z)-1-(5-chlorothiophen-2-yl)butylideneamino]thiophene-2-carboxamide |
| SMILES | CCC/C(=N/NC(=O)c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H13ClN2OS2/c1-2-4-9(10-6-7-12(14)19-10)15-16-13(17)11-5-3-8-18-11/h3,5-8H,2,4H2,1H3,(H,16,17)/b15-9- |
| InChIKey | UIBJPXZBDNESGU-DHDCSXOGSA-N |
| XLogP | 4.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|