C20H24N2O2S — CID 6536354
4-cyclopentyloxy-N-[(Z)-1-thiophen-2-ylbutylideneamino]benzamide (PubChem CID 6536354) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[(Z)-1-thiophen-2-ylbutylideneamino]benzamide.
| Compound Name | 4-cyclopentyloxy-N-[(Z)-1-thiophen-2-ylbutylideneamino]benzamide |
|---|---|
| PubChem CID | 6536354 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-cyclopentyloxy-N-[(Z)-1-thiophen-2-ylbutylideneamino]benzamide |
| SMILES | CCC/C(=N/NC(=O)c1ccc(OC2CCCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C20H24N2O2S/c1-2-6-18(19-9-5-14-25-19)21-22-20(23)15-10-12-17(13-11-15)24-16-7-3-4-8-16/h5,9-14,16H,2-4,6-8H2,1H3,(H,22,23)/b21-18- |
| InChIKey | JROYKEIDAMWWMH-UZYVYHOESA-N |
| XLogP | 5.00 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|